605-02-7 1-Phenylnaphthalene
| Nome do produto |
1-Phenylnaphthalene |
| Nome em inglês |
1-Phenylnaphthalene;NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
| Fórmula molecular |
C16H12 |
| Peso Molecular |
204.2665 |
| InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| CAS Registry Number |
605-02-7 |
| EINECS |
210-081-6 |
| Estrutura Molecular |
|
| Densidade |
1.081g/cm3 |
| Ponto de ebuli??o |
336.4°C at 760 mmHg |
| índice de refra??o |
1.647 |
| O ponto de inflama??o |
148.2°C |
| Press?o de vapor |
0.000219mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|