605-02-7 1-Phenylnaphthalene
| Nom |
1-Phenylnaphthalene |
| Nom anglais |
1-Phenylnaphthalene;NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
| Formule moléculaire |
C16H12 |
| Poids Moléculaire |
204.2665 |
| InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| Numéro de registre CAS |
605-02-7 |
| EINECS |
210-081-6 |
| Structure moléculaire |
|
| Densité |
1.081g/cm3 |
| Point d'ébullition |
336.4°C at 760 mmHg |
| Indice de réfraction |
1.647 |
| Point d'éclair |
148.2°C |
| Pression de vapeur |
0.000219mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|