602-60-8 9-nitroanthracene
| Nome do produto |
9-nitroanthracene |
| Nome em inglês |
9-nitroanthracene; 9-Nitroanthracene (purity); 1-nitroanthracene |
| Fórmula molecular |
C14H9NO2 |
| Peso Molecular |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
| CAS Registry Number |
602-60-8 |
| EINECS |
210-021-9 |
| Estrutura Molecular |
|
| Densidade |
1.316g/cm3 |
| Ponto de fus?o |
144-144℃ |
| Ponto de ebuli??o |
413.3°C at 760 mmHg |
| índice de refra??o |
1.741 |
| O ponto de inflama??o |
207.5°C |
| Press?o de vapor |
1.16E-06mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|