602-60-8 9-nitroanthracene
| product Name |
9-nitroanthracene |
| CAS No |
602-60-8 |
| Synonyms |
9-Nitroanthracene (purity); 1-nitroanthracene |
| Molecular Formula |
C14H9NO2 |
| Molecular Weight |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
| EINECS |
210-021-9 |
| Molecular Structure |
|
| Density |
1.316g/cm3 |
| Melting point |
144-144℃ |
| Boiling point |
413.3°C at 760 mmHg |
| Refractive index |
1.741 |
| Flash point |
207.5°C |
| Vapour Pressur |
1.16E-06mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|