541-46-8 isovaleramide
| Nome do produto |
isovaleramide |
| Nome em inglês |
isovaleramide; Isovaleramide, (3-Methylbutyramide); 3-Methylbutyramide; 3-Methylbutanamide |
| Fórmula molecular |
C5H11NO |
| Peso Molecular |
101.1469 |
| InChI |
InChI=1/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
| CAS Registry Number |
541-46-8 |
| EINECS |
208-781-1 |
| Estrutura Molecular |
|
| Densidade |
0.901g/cm3 |
| Ponto de ebuli??o |
232°C at 760 mmHg |
| índice de refra??o |
1.425 |
| O ponto de inflama??o |
94.1°C |
| Press?o de vapor |
0.0605mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|