541-46-8 isovaleramide
| product Name |
isovaleramide |
| CAS No |
541-46-8 |
| Synonyms |
Isovaleramide, (3-Methylbutyramide); 3-Methylbutyramide; 3-Methylbutanamide |
| Molecular Formula |
C5H11NO |
| Molecular Weight |
101.1469 |
| InChI |
InChI=1/C5H11NO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3,(H2,6,7) |
| EINECS |
208-781-1 |
| Molecular Structure |
|
| Density |
0.901g/cm3 |
| Boiling point |
232°C at 760 mmHg |
| Refractive index |
1.425 |
| Flash point |
94.1°C |
| Vapour Pressur |
0.0605mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|