ChemNet > CAS > 5379-16-8 3,5-Dimethylacetophenone
5379-16-8 3,5-Dimethylacetophenone
| Nome do produto |
3,5-Dimethylacetophenone |
| Nome em inglês |
3,5-Dimethylacetophenone; 3',5'-Dimethylacetophenone |
| Fórmula molecular |
C10H12O |
| Peso Molecular |
148.2 |
| InChI |
InChI=1S/C10H12O/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6H,1-3H3 |
| CAS Registry Number |
5379-16-8 |
| Estrutura Molecular |
|
| Densidade |
0.965g/cm3 |
| Ponto de fus?o |
20°C |
| Ponto de ebuli??o |
98-100°C 8mm |
| O ponto de inflama??o |
93.2°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|