ChemNet > CAS > 5379-16-8 3,5-Dimethylacetophenone
5379-16-8 3,5-Dimethylacetophenone
| product Name |
3,5-Dimethylacetophenone |
| CAS No |
5379-16-8 |
| Synonyms |
3',5'-Dimethylacetophenone |
| Molecular Formula |
C10H12O |
| Molecular Weight |
148.2 |
| InChI |
InChI=1S/C10H12O/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6H,1-3H3 |
| Molecular Structure |
|
| Density |
0.965g/cm3 |
| Melting point |
20°C |
| Boiling point |
98-100°C 8mm |
| Flash point |
93.2°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr.Yu |
| Telephone |
+86-24-31204918 |
| Email |
sales@mole-pharm.com |
| Address |
No,17-1, Wensu Street, Hunnan New Area, Shenyang City,Liaoning Privince ,China |