5111-69-3 5-methoxyindan
| Nome do produto |
5-methoxyindan |
| Nome em inglês |
5-methoxyindan; |
| Fórmula molecular |
C10H12O |
| Peso Molecular |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-11-10-6-5-8-3-2-4-9(8)7-10/h5-7H,2-4H2,1H3 |
| CAS Registry Number |
5111-69-3 |
| Estrutura Molecular |
|
| Densidade |
1.039g/cm3 |
| Ponto de ebuli??o |
231.9°C at 760 mmHg |
| índice de refra??o |
1.545 |
| O ponto de inflama??o |
98.3°C |
| Press?o de vapor |
0.0924mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|