5111-69-3 5-methoxyindan
| Nome del prodotto |
5-methoxyindan |
| Nome inglese |
5-methoxyindan; |
| Formula molecolare |
C10H12O |
| Peso Molecolare |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-11-10-6-5-8-3-2-4-9(8)7-10/h5-7H,2-4H2,1H3 |
| Numero CAS |
5111-69-3 |
| Struttura molecolare |
|
| Densità |
1.039g/cm3 |
| Punto di ebollizione |
231.9°C at 760 mmHg |
| Indice di rifrazione |
1.545 |
| Punto d'infiammabilità |
98.3°C |
| Pressione di vapore |
0.0924mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|