447-53-0 1,2-Dihydronaphthalene
| Nome do produto |
1,2-Dihydronaphthalene |
| Nome em inglês |
1,2-Dihydronaphthalene; 1,2-DIHYDRONAPHTHALENE; naphthalene, 1,2-dihydro- |
| Fórmula molecular |
C10H10 |
| Peso Molecular |
130.1864 |
| InChI |
InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| CAS Registry Number |
447-53-0 |
| EINECS |
207-183-8 |
| Estrutura Molecular |
|
| Densidade |
1.004g/cm3 |
| Ponto de fus?o |
-8℃ |
| Ponto de ebuli??o |
204.9°C at 760 mmHg |
| índice de refra??o |
1.572 |
| O ponto de inflama??o |
70.4°C |
| Press?o de vapor |
0.367mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|