447-53-0 1,2-Dihydronaphthalene
| product Name |
1,2-Dihydronaphthalene |
| CAS No |
447-53-0 |
| Synonyms |
1,2-DIHYDRONAPHTHALENE; naphthalene, 1,2-dihydro- |
| Molecular Formula |
C10H10 |
| Molecular Weight |
130.1864 |
| InChI |
InChI=1/C10H10/c1-2-6-10-8-4-3-7-9(10)5-1/h1-3,5-7H,4,8H2 |
| EINECS |
207-183-8 |
| Molecular Structure |
|
| Density |
1.004g/cm3 |
| Melting point |
-8℃ |
| Boiling point |
204.9°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
70.4°C |
| Vapour Pressur |
0.367mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|