37529-27-4 4-heptylaniline
| Nome do produto |
4-heptylaniline |
| Nome em inglês |
4-heptylaniline; Heptylaniline; 4-n-Heptyaniline |
| Fórmula molecular |
C13H21N |
| Peso Molecular |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| CAS Registry Number |
37529-27-4 |
| Estrutura Molecular |
|
| Densidade |
0.923g/cm3 |
| Ponto de ebuli??o |
282.9°C at 760 mmHg |
| índice de refra??o |
1.522 |
| O ponto de inflama??o |
128.9°C |
| Press?o de vapor |
0.00327mmHg at 25°C |
| Símbolos de perigo |
Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|