37529-27-4 4-heptylaniline
| Nazwa produktu: |
4-heptylaniline |
| Angielska nazwa |
4-heptylaniline; Heptylaniline; 4-n-Heptyaniline |
| MF |
C13H21N |
| Masie cz?steczkowej |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| Nr CAS |
37529-27-4 |
| Struktury molekularnej |
|
| G?sto?? |
0.923g/cm3 |
| Temperatura wrzenia |
282.9°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.522 |
| Temperatura zap?onu |
128.9°C |
| Ci?nienie pary |
0.00327mmHg at 25°C |
| Symbole zagro?enia |
Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|