ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
| Nome do produto |
3,4-Dichlorophenethylalcohol |
| Nome em inglês |
3,4-Dichlorophenethylalcohol; 2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
| Fórmula molecular |
C8H8Cl2O |
| Peso Molecular |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
| CAS Registry Number |
35364-79-5 |
| Estrutura Molecular |
|
| Densidade |
1.329g/cm3 |
| Ponto de ebuli??o |
279.1°C at 760 mmHg |
| índice de refra??o |
1.569 |
| O ponto de inflama??o |
117.9°C |
| Press?o de vapor |
0.00196mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|