ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
| product Name |
3,4-Dichlorophenethylalcohol |
| CAS No |
35364-79-5 |
| Synonyms |
2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
| Molecular Formula |
C8H8Cl2O |
| Molecular Weight |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
| Molecular Structure |
|
| Density |
1.329g/cm3 |
| Boiling point |
279.1°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
117.9°C |
| Vapour Pressur |
0.00196mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Feng Xuezhen;Wang Jiujin |
| Telephone |
+86-518-88581638 |
| Email |
fxz@chundachem.com |
| Address |
Weiwu Road, Lingang Industrial Zone, Guanyun County, Jiangsu Province, China |