3068-88-0 beta-butyrolactone
| Nome do produto |
beta-butyrolactone |
| Nome em inglês |
beta-butyrolactone; Butyrolactone; dl-B-hydroxybutyric acid lactone; 3-Hydroxybutyric acid lactone; 4-Methyl-2-oxetanone; 2-Methyl-beta-propiolactone; dihydrofuran-2(3H)-one; (4R)-4-methyloxetan-2-one; (4S)-4-methyloxetan-2-one; (R)-BETA-BUTYROLACTONE |
| Fórmula molecular |
C4H6O2 |
| Peso Molecular |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
| CAS Registry Number |
3068-88-0 |
| EINECS |
221-330-3 |
| Estrutura Molecular |
|
| Densidade |
1.096g/cm3 |
| Ponto de ebuli??o |
163.2°C at 760 mmHg |
| índice de refra??o |
1.429 |
| O ponto de inflama??o |
34.1°C |
| Press?o de vapor |
2.09mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R45:May cause cancer.;
|
| Descri??o da Seguran?a |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|