3068-88-0 beta-butyrolactone
| ??? ????? |
beta-butyrolactone |
| ??? ??????? |
beta-butyrolactone; Butyrolactone; dl-B-hydroxybutyric acid lactone; 3-Hydroxybutyric acid lactone; 4-Methyl-2-oxetanone; 2-Methyl-beta-propiolactone; dihydrofuran-2(3H)-one; (4R)-4-methyloxetan-2-one; (4S)-4-methyloxetan-2-one; (R)-BETA-BUTYROLACTONE |
| ????? ???????? |
C4H6O2 |
| ??? ??????? |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3/t3-/m0/s1 |
| ????? ?????? |
3068-88-0 |
| ????? ??????? ??????? |
221-330-3 |
| ?????? ??????? |
|
| ????? |
1.096g/cm3 |
| ???? ????? |
163.2°C at 760 mmHg |
| ???? ???? |
1.429 |
| ???? ?????? |
34.1°C |
| ???? ???? |
2.09mmHg at 25°C |
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R45:May cause cancer.;
|
| ??????? ????? |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|