301-00-8 methyl linolenate
| Nome do produto |
methyl linolenate |
| Nome em inglês |
methyl linolenate; |
| Fórmula molecular |
C19H32O2 |
| Peso Molecular |
292.4562 |
| InChI |
InChI=1/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
| CAS Registry Number |
301-00-8 |
| EINECS |
206-102-3 |
| Estrutura Molecular |
|
| Densidade |
0.895g/cm3 |
| Ponto de ebuli??o |
364.4°C at 760 mmHg |
| índice de refra??o |
1.475 |
| O ponto de inflama??o |
101.4°C |
| Press?o de vapor |
1.69E-05mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|