301-00-8 methyl linolenate
| Nome del prodotto |
methyl linolenate |
| Nome inglese |
methyl linolenate; |
| Formula molecolare |
C19H32O2 |
| Peso Molecolare |
292.4562 |
| InChI |
InChI=1/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b5-4-,8-7-,11-10- |
| Numero CAS |
301-00-8 |
| EINECS |
206-102-3 |
| Struttura molecolare |
|
| Densità |
0.895g/cm3 |
| Punto di ebollizione |
364.4°C at 760 mmHg |
| Indice di rifrazione |
1.475 |
| Punto d'infiammabilità |
101.4°C |
| Pressione di vapore |
1.69E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|