2216-87-7 3-Undecanone
| Nome do produto |
3-Undecanone |
| Nome em inglês |
3-Undecanone; Ethyl n-octyl ketone; undecan-3-one |
| Fórmula molecular |
C11H22O |
| Peso Molecular |
170.2918 |
| InChI |
InChI=1/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-10H2,1-2H3 |
| CAS Registry Number |
2216-87-7 |
| EINECS |
218-700-1 |
| Estrutura Molecular |
|
| Densidade |
0.821g/cm3 |
| Ponto de ebuli??o |
226.9°C at 760 mmHg |
| índice de refra??o |
1.425 |
| O ponto de inflama??o |
73.2°C |
| Press?o de vapor |
0.0797mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|