2216-87-7 3-Undecanone
| Nome del prodotto |
3-Undecanone |
| Nome inglese |
3-Undecanone; Ethyl n-octyl ketone; undecan-3-one |
| Formula molecolare |
C11H22O |
| Peso Molecolare |
170.2918 |
| InChI |
InChI=1/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-10H2,1-2H3 |
| Numero CAS |
2216-87-7 |
| EINECS |
218-700-1 |
| Struttura molecolare |
|
| Densità |
0.821g/cm3 |
| Punto di ebollizione |
226.9°C at 760 mmHg |
| Indice di rifrazione |
1.425 |
| Punto d'infiammabilità |
73.2°C |
| Pressione di vapore |
0.0797mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|