1210-34-0 Dibenzosuberol
| Nome do produto |
Dibenzosuberol |
| Nome em inglês |
Dibenzosuberol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
| Fórmula molecular |
C15H14O |
| Peso Molecular |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
| CAS Registry Number |
1210-34-0 |
| EINECS |
214-911-8 |
| Estrutura Molecular |
|
| Densidade |
1.163g/cm3 |
| Ponto de fus?o |
90-95℃ |
| Ponto de ebuli??o |
365.5°C at 760 mmHg |
| índice de refra??o |
1.633 |
| O ponto de inflama??o |
135.6°C |
| Press?o de vapor |
5.51E-06mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|