1210-34-0 Dibenzosuberol
| Nama produk |
Dibenzosuberol |
| Nama bahasa Inggris |
Dibenzosuberol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohepten-5-ol; dibenzo(b,f)cycloheptan-1-ol; Dibenzo[b,f]-1-cycloheptanol; 10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-ol; 10,11-Dihydro-5H-dibenzo[a,d]cyclohetpten-5-ol |
| MF |
C15H14O |
| Berat Molekul |
210.2711 |
| InChI |
InChI=1/C15H14O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2 |
| CAS NO |
1210-34-0 |
| EINECS |
214-911-8 |
| Struktur Molekul |
|
| Kepadatan |
1.163g/cm3 |
| Titik lebur |
90-95℃ |
| Titik didih |
365.5°C at 760 mmHg |
| Indeks bias |
1.633 |
| Titik nyala |
135.6°C |
| Tekanan uap |
5.51E-06mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|