1122-60-7 nitrociclohexano
| Nome do produto |
nitrociclohexano |
| Sin?nimos |
Hexahidronitrobenzeno |
| Nome em inglês |
nitrocyclohexane; Hexahydronitrobenzene |
| Fórmula molecular |
C6H11NO2 |
| Peso Molecular |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| CAS Registry Number |
1122-60-7 |
| EINECS |
214-354-0 |
| Estrutura Molecular |
|
| Densidade |
1.05g/cm3 |
| Ponto de ebuli??o |
202.8°C at 760 mmHg |
| índice de refra??o |
1.465 |
| O ponto de inflama??o |
81.2°C |
| Press?o de vapor |
0.287mmHg at 25°C |
| Códigos de risco |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|