1122-60-7 nitrosikloheksan
| ürün Ad? |
nitrosikloheksan |
| E? anlaml? |
Heksahidronitrobenzen;
|
| ingilizce ad? |
nitrocyclohexane; Hexahydronitrobenzene |
| Moleküler Formülü |
C6H11NO2 |
| Molekül A??rl??? |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| CAS kay?t numaras? |
1122-60-7 |
| EINECS |
214-354-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.05g/cm3 |
| Kaynama noktas? |
202.8°C at 760 mmHg |
| K?r?lma indisi |
1.465 |
| Alevlenme noktas? |
81.2°C |
| Buhar bas?nc? |
0.287mmHg at 25°C |
| Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|