1122-60-7 nitrocykloheksan
| Nazwa produktu: |
nitrocykloheksan |
| Synonimy |
Heksahydronitrobenzen |
| Angielska nazwa |
nitrocyclohexane; Hexahydronitrobenzene |
| MF |
C6H11NO2 |
| Masie cz?steczkowej |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| Nr CAS |
1122-60-7 |
| EINECS |
214-354-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.05g/cm3 |
| Temperatura wrzenia |
202.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.465 |
| Temperatura zap?onu |
81.2°C |
| Ci?nienie pary |
0.287mmHg at 25°C |
| Kody ryzyka |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|