110-41-8 2-Methylundecanal
| Nome do produto |
2-Methylundecanal |
| Nome em inglês |
2-Methylundecanal; |
| Fórmula molecular |
C12H22O |
| Peso Molecular |
182.3025 |
| InChI |
InChI=1/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h10-11H,3-9H2,1-2H3 |
| CAS Registry Number |
110-41-8 |
| EINECS |
203-765-0 |
| Estrutura Molecular |
|
| Densidade |
0.838g/cm3 |
| Ponto de ebuli??o |
262.7°C at 760 mmHg |
| índice de refra??o |
1.443 |
| O ponto de inflama??o |
81.4°C |
| Press?o de vapor |
0.0107mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|