110-41-8 2-Methylundecanal
| Nome del prodotto |
2-Methylundecanal |
| Nome inglese |
2-Methylundecanal; |
| Formula molecolare |
C12H22O |
| Peso Molecolare |
182.3025 |
| InChI |
InChI=1/C12H22O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h10-11H,3-9H2,1-2H3 |
| Numero CAS |
110-41-8 |
| EINECS |
203-765-0 |
| Struttura molecolare |
|
| Densità |
0.838g/cm3 |
| Punto di ebollizione |
262.7°C at 760 mmHg |
| Indice di rifrazione |
1.443 |
| Punto d'infiammabilità |
81.4°C |
| Pressione di vapore |
0.0107mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|