1074-16-4 2-Bromophenethylalcohol
| Nome do produto |
2-Bromophenethylalcohol |
| Nome em inglês |
2-Bromophenethylalcohol; 2-(2-Bromophenyl)-ethanol |
| Fórmula molecular |
C8H9BrO |
| Peso Molecular |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| CAS Registry Number |
1074-16-4 |
| Estrutura Molecular |
|
| Densidade |
1.479g/cm3 |
| Ponto de ebuli??o |
269.3°C at 760 mmHg |
| índice de refra??o |
1.576 |
| O ponto de inflama??o |
116.7°C |
| Press?o de vapor |
0.0036mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|