1074-16-4 2-Bromophenethylalcohol
| Nome del prodotto |
2-Bromophenethylalcohol |
| Nome inglese |
2-Bromophenethylalcohol; 2-(2-Bromophenyl)-ethanol |
| Formula molecolare |
C8H9BrO |
| Peso Molecolare |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| Numero CAS |
1074-16-4 |
| Struttura molecolare |
|
| Densità |
1.479g/cm3 |
| Punto di ebollizione |
269.3°C at 760 mmHg |
| Indice di rifrazione |
1.576 |
| Punto d'infiammabilità |
116.7°C |
| Pressione di vapore |
0.0036mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|