1073-29-6 2-Hydroxythioanisole
| Nome do produto |
2-Hydroxythioanisole |
| Nome em inglês |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| Fórmula molecular |
C7H8OS |
| Peso Molecular |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| CAS Registry Number |
1073-29-6 |
| EINECS |
214-027-2 |
| Estrutura Molecular |
|
| Densidade |
1.19g/cm3 |
| Ponto de ebuli??o |
206.1°C at 760 mmHg |
| índice de refra??o |
1.613 |
| O ponto de inflama??o |
108°C |
| Press?o de vapor |
0.168mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|