1073-29-6 2-Hydroxythioanisole
| Ονομασ?α του προ??ντο? |
2-Hydroxythioanisole |
| Αγγλικ? ?νομα |
2-Hydroxythioanisole; 2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
| MF |
C7H8OS |
| Μοριακ? β?ρο? |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
| CAS ΟΧΙ |
1073-29-6 |
| EINECS |
214-027-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.19g/cm3 |
| Σημε?ο βρασμο? |
206.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.613 |
| Σημε?ο αν?φλεξη? |
108°C |
| Π?εση ατμ?ν |
0.168mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|