105-05-5 1,4-Diethylbenzene
| Nome do produto |
1,4-Diethylbenzene |
| Nome em inglês |
1,4-Diethylbenzene; Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
| Fórmula molecular |
C10H14 |
| Peso Molecular |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| CAS Registry Number |
105-05-5 |
| EINECS |
203-265-2 |
| Estrutura Molecular |
|
| Densidade |
0.86g/cm3 |
| Ponto de fus?o |
-43℃ |
| Ponto de ebuli??o |
173.3°C at 760 mmHg |
| índice de refra??o |
1.489 |
| O ponto de inflama??o |
46.3°C |
| Press?o de vapor |
1.7mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|