105-05-5 1,4-Diethylbenzene
| Nome del prodotto |
1,4-Diethylbenzene |
| Nome inglese |
1,4-Diethylbenzene; Benzene, 1,4-diethyl-; Benzene, p-diethyl-; HSDB 4083; p-Diethylbenzene; p-Ethylethylbenzene; butan-2-ylbenzene; PDEB |
| Formula molecolare |
C10H14 |
| Peso Molecolare |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 |
| Numero CAS |
105-05-5 |
| EINECS |
203-265-2 |
| Struttura molecolare |
|
| Densità |
0.86g/cm3 |
| Punto di fusione |
-43℃ |
| Punto di ebollizione |
173.3°C at 760 mmHg |
| Indice di rifrazione |
1.489 |
| Punto d'infiammabilità |
46.3°C |
| Pressione di vapore |
1.7mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|