103-30-0 trans-Stilbene
| Nome do produto |
trans-Stilbene |
| Nome em inglês |
trans-Stilbene; trans-1,1-(1,2-Ethenediyl)bis(benzene); 1,1'-ethene-1,1-diyldibenzene; 1,1'-(E)-ethene-1,2-diyldibenzene; 1,1'-(Z)-ethene-1,2-diyldibenzene |
| Fórmula molecular |
C14H12 |
| Peso Molecular |
180.2451 |
| InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| CAS Registry Number |
103-30-0 |
| EINECS |
203-098-5 |
| Estrutura Molecular |
|
| Densidade |
1.044g/cm3 |
| Ponto de fus?o |
122-126℃ |
| Ponto de ebuli??o |
307°C at 760 mmHg |
| índice de refra??o |
1.658 |
| O ponto de inflama??o |
128.5°C |
| Press?o de vapor |
0.00135mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|