103-30-0 trans-Stilbene
| Nome del prodotto |
trans-Stilbene |
| Nome inglese |
trans-Stilbene; trans-1,1-(1,2-Ethenediyl)bis(benzene); 1,1'-ethene-1,1-diyldibenzene; 1,1'-(E)-ethene-1,2-diyldibenzene; 1,1'-(Z)-ethene-1,2-diyldibenzene |
| Formula molecolare |
C14H12 |
| Peso Molecolare |
180.2451 |
| InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Numero CAS |
103-30-0 |
| EINECS |
203-098-5 |
| Struttura molecolare |
|
| Densità |
1.044g/cm3 |
| Punto di fusione |
122-126℃ |
| Punto di ebollizione |
307°C at 760 mmHg |
| Indice di rifrazione |
1.658 |
| Punto d'infiammabilità |
128.5°C |
| Pressione di vapore |
0.00135mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|