947-72-8 9-Chlorophenanthrene
| Nazwa produktu: |
9-Chlorophenanthrene |
| Angielska nazwa |
9-Chlorophenanthrene;Phenanthrene, 9-chloro-; 10-Chlorophenanthrene; 4-05-00-02303 (Beilstein Handbook Reference); AI3-24095; BRN 2047058; CCRIS 5543; NSC 8552 |
| MF |
C14H9Cl |
| Masie cz?steczkowej |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| Nr CAS |
947-72-8 |
| EINECS |
213-430-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.253g/cm3 |
| Temperatura topnienia |
46-50℃ |
| Temperatura wrzenia |
370.1°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.717 |
| Temperatura zap?onu |
179.2°C |
| Ci?nienie pary |
2.42E-05mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|