947-72-8 9-Chlorophenanthrene
| Naam product |
9-Chlorophenanthrene |
| Engelse naam |
9-Chlorophenanthrene;Phenanthrene, 9-chloro-; 10-Chlorophenanthrene; 4-05-00-02303 (Beilstein Handbook Reference); AI3-24095; BRN 2047058; CCRIS 5543; NSC 8552 |
| MF |
C14H9Cl |
| Molecuulgewicht |
212.6743 |
| InChI |
InChI=1/C14H9Cl/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| CAS-nummer |
947-72-8 |
| EINECS |
213-430-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.253g/cm3 |
| Smeltpunt |
46-50℃ |
| Kookpunt |
370.1°C at 760 mmHg |
| Brekingsindex |
1.717 |
| Vlampunt |
179.2°C |
| Dampdruk |
2.42E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|