5197-28-4 2-Bromo-4-nitroanisole
| Nazwa produktu: |
2-Bromo-4-nitroanisole |
| Angielska nazwa |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| MF |
C7H6BrNO3 |
| Masie cz?steczkowej |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| Nr CAS |
5197-28-4 |
| EINECS |
225-983-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.64g/cm3 |
| Temperatura topnienia |
104-106℃ |
| Temperatura wrzenia |
306.3°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.581 |
| Temperatura zap?onu |
139.1°C |
| Ci?nienie pary |
0.00141mmHg at 25°C |
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|