5197-28-4 2-Bromo-4-nitroanisole
| Nama produk |
2-Bromo-4-nitroanisole |
| Nama bahasa Inggris |
2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| MF |
C7H6BrNO3 |
| Berat Molekul |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| CAS NO |
5197-28-4 |
| EINECS |
225-983-5 |
| Struktur Molekul |
|
| Kepadatan |
1.64g/cm3 |
| Titik lebur |
104-106℃ |
| Titik didih |
306.3°C at 760 mmHg |
| Indeks bias |
1.581 |
| Titik nyala |
139.1°C |
| Tekanan uap |
0.00141mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|