ChemNet > CAS > 92-46-6 6-Chloro-2-methylquinoline
92-46-6 6-Chloro-2-methylquinoline
| produktnavn |
6-Chloro-2-methylquinoline |
| Engelsk navn |
6-Chloro-2-methylquinoline; 6-Chloroquinaldine; 2-Methyl-6-chloroquinoline |
| Molekyl?r Formel |
C10H8ClN |
| Molekylvekt |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,1H3 |
| CAS-nummer |
92-46-6 |
| Molecular Structure |
|
| Tetthet |
1.225g/cm3 |
| Kokepunkt |
278.2°C at 760 mmHg |
| Brytningsindeks |
1.634 |
| Flammepunktet |
148.7°C |
| Damptrykk |
0.00732mmHg at 25°C |
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|