ChemNet > CAS > 92-46-6 6-Chloro-2-methylquinoline
92-46-6 6-Chloro-2-methylquinoline
| product Name |
6-Chloro-2-methylquinoline |
| CAS No |
92-46-6 |
| Synonyms |
6-Chloroquinaldine; 2-Methyl-6-chloroquinoline |
| Molecular Formula |
C10H8ClN |
| Molecular Weight |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,1H3 |
| Molecular Structure |
|
| Density |
1.225g/cm3 |
| Boiling point |
278.2°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
148.7°C |
| Vapour Pressur |
0.00732mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|