4819-77-6 Triethoxyethane
| produktnavn |
Triethoxyethane |
| Engelsk navn |
Triethoxyethane; 1,1,2-Triethoxyethane; Ethoxyacetaldehyde diethyl acetal |
| Molekyl?r Formel |
C8H18O3 |
| Molekylvekt |
162.2267 |
| InChI |
InChI=1/C8H18O3/c1-4-9-7-8(10-5-2)11-6-3/h8H,4-7H2,1-3H3 |
| CAS-nummer |
4819-77-6 |
| EINECS |
225-394-3 |
| Molecular Structure |
|
| Tetthet |
0.901g/cm3 |
| Kokepunkt |
180.9°C at 760 mmHg |
| Brytningsindeks |
1.406 |
| Flammepunktet |
59.6°C |
| Damptrykk |
1.19mmHg at 25°C |
| Risiko Koder |
R10:Flammable.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|