4819-77-6 Triethoxyethane
| product Name |
Triethoxyethane |
| CAS No |
4819-77-6 |
| Synonyms |
1,1,2-Triethoxyethane; Ethoxyacetaldehyde diethyl acetal |
| Molecular Formula |
C8H18O3 |
| Molecular Weight |
162.2267 |
| InChI |
InChI=1/C8H18O3/c1-4-9-7-8(10-5-2)11-6-3/h8H,4-7H2,1-3H3 |
| EINECS |
225-394-3 |
| Molecular Structure |
|
| Density |
0.901g/cm3 |
| Boiling point |
180.9°C at 760 mmHg |
| Refractive index |
1.406 |
| Flash point |
59.6°C |
| Vapour Pressur |
1.19mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |