ChemNet > CAS > 85-81-4 6-Methoxy-8-nitroquinoline
85-81-4 6-Methoxy-8-nitroquinoline
| Naam product |
6-Methoxy-8-nitroquinoline |
| Engelse naam |
6-Methoxy-8-nitroquinoline; 6-Methoxy-8-Nitro quinoline; methyl 8-nitro-6-quinolyl ether; 6-Metoxy-8-nitroquinoline, 99% |
| MF |
C10H8N2O3 |
| Molecuulgewicht |
204.1821 |
| InChI |
InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
| CAS-nummer |
85-81-4 |
| EINECS |
201-633-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.337g/cm3 |
| Smeltpunt |
158-162℃ |
| Kookpunt |
373.1°C at 760 mmHg |
| Brekingsindex |
1.646 |
| Vlampunt |
179.4°C |
| Dampdruk |
1.97E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|