ChemNet > CAS > 85-81-4 6-Methoxy-8-nitroquinoline
85-81-4 6-Methoxy-8-nitroquinoline
| product Name |
6-Methoxy-8-nitroquinoline |
| CAS No |
85-81-4 |
| Synonyms |
6-Methoxy-8-Nitro quinoline; methyl 8-nitro-6-quinolyl ether; 6-Metoxy-8-nitroquinoline, 99% |
| Molecular Formula |
C10H8N2O3 |
| Molecular Weight |
204.1821 |
| InChI |
InChI=1/C10H8N2O3/c1-15-8-5-7-3-2-4-11-10(7)9(6-8)12(13)14/h2-6H,1H3 |
| EINECS |
201-633-7 |
| Molecular Structure |
|
| Density |
1.337g/cm3 |
| Melting point |
158-162℃ |
| Boiling point |
373.1°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
179.4°C |
| Vapour Pressur |
1.97E-05mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Wenxu |
| Telephone |
+86-519-85525329 |
| Email |
anna@xuanmingchem.com |
| Address |
No.120, Hanjiang Road, Xinbei District, Changzhou City, Jiangsu Province, China |
| Telephone |
+86-21-54450828,+86-13501997194 |
| Email |
coco.yang@fwdchem.com |
| Address |
Room 802,Lotus Tower ,159 Tianzhou Road, Xuhui District,Shanghai 200233 ,P.R.China |