608-08-2 Indoxyl acetate
| Naam product |
Indoxyl acetate |
| Engelse naam |
Indoxyl acetate; 3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
| MF |
C10H9NO2 |
| Molecuulgewicht |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| CAS-nummer |
608-08-2 |
| EINECS |
210-154-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.255g/cm3 |
| Smeltpunt |
128-131℃ |
| Kookpunt |
339.1°C at 760 mmHg |
| Brekingsindex |
1.633 |
| Vlampunt |
158.9°C |
| Dampdruk |
9.41E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|