608-08-2 Indoxyl acetate
| Nome del prodotto |
Indoxyl acetate |
| Nome inglese |
Indoxyl acetate; 3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
| Formula molecolare |
C10H9NO2 |
| Peso Molecolare |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| Numero CAS |
608-08-2 |
| EINECS |
210-154-2 |
| Struttura molecolare |
|
| Densità |
1.255g/cm3 |
| Punto di fusione |
128-131℃ |
| Punto di ebollizione |
339.1°C at 760 mmHg |
| Indice di rifrazione |
1.633 |
| Punto d'infiammabilità |
158.9°C |
| Pressione di vapore |
9.41E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|