ChemNet > CAS > 5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
5307-17-5 Methyl 3-methoxy-2-nitrobenzoate
| Naam product |
Methyl 3-methoxy-2-nitrobenzoate |
| Engelse naam |
Methyl 3-methoxy-2-nitrobenzoate; 3-Methoxy-2-nitrobenzoic acid methyl ester; 3-Methoxy-2-nitromethylbenzoate |
| MF |
C9H9NO5 |
| Molecuulgewicht |
211.1715 |
| InChI |
InChI=1/C9H9NO5/c1-14-7-5-3-4-6(9(11)15-2)8(7)10(12)13/h3-5H,1-2H3 |
| CAS-nummer |
5307-17-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.294g/cm3 |
| Kookpunt |
325.4°C at 760 mmHg |
| Brekingsindex |
1.54 |
| Vlampunt |
151.5°C |
| Dampdruk |
0.00023mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|